C19H19F2NO5S — CID 59610051
methyl 2-(2,4-difluorophenoxy)-2-(4-pyrrolidin-1-ylsulfonylphenyl)acetate (PubChem CID 59610051) has the molecular formula C19H19F2NO5S and a molecular weight of 411.43 g/mol. Its IUPAC name is methyl 2-(2,4-difluorophenoxy)-2-(4-pyrrolidin-1-ylsulfonylphenyl)acetate.
| Compound Name | methyl 2-(2,4-difluorophenoxy)-2-(4-pyrrolidin-1-ylsulfonylphenyl)acetate |
|---|---|
| PubChem CID | 59610051 |
| Molecular Formula | C19H19F2NO5S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | methyl 2-(2,4-difluorophenoxy)-2-(4-pyrrolidin-1-ylsulfonylphenyl)acetate |
| SMILES | COC(=O)C(Oc1ccc(F)cc1F)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H19F2NO5S/c1-26-19(23)18(27-17-9-6-14(20)12-16(17)21)13-4-7-15(8-5-13)28(24,25)22-10-2-3-11-22/h4-9,12,18H,2-3,10-11H2,1H3 |
| InChIKey | MDDGJBBFKOQLHE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |