About carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+)
carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+) (PubChem CID 59610445) has the molecular formula C9H17NO3V
and a molecular weight of 238.18 g/mol. Its IUPAC name is carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+).
Molecular Properties
| Compound Name | carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+) |
| PubChem CID | 59610445 |
| Molecular Formula | C9H17NO3V |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+) |
| SMILES | CCCC(CN(C)[C-]=O)C(=O)O.[CH3-].[V+2] |
| InChI | InChI=1S/C8H14NO3.CH3.V/c1-3-4-7(8(11)12)5-9(2)6-10;;/h7H,3-5H2,1-2H3,(H,11,12);1H3;/q2*-1;+2 |
| InChIKey | NEZIKXBXYCDPQG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+)?
The IUPAC name of carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+) (CID 59610445) is carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+).
What is the SMILES notation for carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+)?
The canonical SMILES for carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+) is CCCC(CN(C)[C-]=O)C(=O)O.[CH3-].[V+2].
What is the InChIKey of carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+)?
The InChIKey is NEZIKXBXYCDPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14NO3.CH3.V/c1-3-4-7(8(11)12)5-9(2)6-10;;/h7H,3-5H2,1-2H3,(H,11,12);1H3;/q2*-1;+2.
What are the key properties of carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+)?
carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+) has a molecular weight of 238.18 g/mol, XLogP of 0.93, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-[[methyl(oxomethyl)amino]methyl]pentanoic acid;vanadium(2+) is sourced from PubChem (CID 59610445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).