C15H29O3Y- — CID 59611839
5-methanidyl-6-(6-methyl-2-propyl-1,3-dioxan-4-yl)hexan-3-ol;yttrium (PubChem CID 59611839) has the molecular formula C15H29O3Y- and a molecular weight of 346.30 g/mol. Its IUPAC name is 5-methanidyl-6-(6-methyl-2-propyl-1,3-dioxan-4-yl)hexan-3-ol;yttrium.
| Compound Name | 5-methanidyl-6-(6-methyl-2-propyl-1,3-dioxan-4-yl)hexan-3-ol;yttrium |
|---|---|
| PubChem CID | 59611839 |
| Molecular Formula | C15H29O3Y- |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 5-methanidyl-6-(6-methyl-2-propyl-1,3-dioxan-4-yl)hexan-3-ol;yttrium |
| SMILES | [CH2-]C(CC(O)CC)CC1CC(C)OC(CCC)O1.[Y] |
| InChI | InChI=1S/C15H29O3.Y/c1-5-7-15-17-12(4)10-14(18-15)9-11(3)8-13(16)6-2;/h11-16H,3,5-10H2,1-2,4H3;/q-1; |
| InChIKey | AODXGILRBFPISL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|