C15H11N5OS — CID 59615715
N-[4-methyl-5-(2-pyridin-3-ylethynyl)-1,3-thiazol-2-yl]imidazole-1-carboxamide (PubChem CID 59615715) has the molecular formula C15H11N5OS and a molecular weight of 309.35 g/mol. Its IUPAC name is N-[4-methyl-5-(2-pyridin-3-ylethynyl)-1,3-thiazol-2-yl]imidazole-1-carboxamide.
| Compound Name | N-[4-methyl-5-(2-pyridin-3-ylethynyl)-1,3-thiazol-2-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 59615715 |
| Molecular Formula | C15H11N5OS |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-[4-methyl-5-(2-pyridin-3-ylethynyl)-1,3-thiazol-2-yl]imidazole-1-carboxamide |
| SMILES | Cc1nc(NC(=O)n2ccnc2)sc1C#Cc1cccnc1 |
| InChI | InChI=1S/C15H11N5OS/c1-11-13(5-4-12-3-2-6-16-9-12)22-14(18-11)19-15(21)20-8-7-17-10-20/h2-3,6-10H,1H3,(H,18,19,21) |
| InChIKey | AEWRHFYXJGDGRL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|