C13H14N4O2S — CID 143575795
(E)-N-[5-(imidazole-1-carbonyl)-4-methyl-1,3-thiazol-2-yl]-2-methylbut-2-enamide (PubChem CID 143575795) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is (E)-N-[5-(imidazole-1-carbonyl)-4-methyl-1,3-thiazol-2-yl]-2-methylbut-2-enamide.
| Compound Name | (E)-N-[5-(imidazole-1-carbonyl)-4-methyl-1,3-thiazol-2-yl]-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 143575795 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (E)-N-[5-(imidazole-1-carbonyl)-4-methyl-1,3-thiazol-2-yl]-2-methylbut-2-enamide |
| SMILES | C/C=C(\C)C(=O)Nc1nc(C)c(C(=O)n2ccnc2)s1 |
| InChI | InChI=1S/C13H14N4O2S/c1-4-8(2)11(18)16-13-15-9(3)10(20-13)12(19)17-6-5-14-7-17/h4-7H,1-3H3,(H,15,16,18)/b8-4+ |
| InChIKey | JVNHZXONGDHDQZ-XBXARRHUSA-N |
| XLogP | 2.24 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|