C17H21FN6OS — CID 89091301
N-[5-[(1Z)-1-[(1-amino-3-fluoro-2,2-dimethylpropylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide (PubChem CID 89091301) has the molecular formula C17H21FN6OS and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[5-[(1Z)-1-[(1-amino-3-fluoro-2,2-dimethylpropylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide.
| Compound Name | N-[5-[(1Z)-1-[(1-amino-3-fluoro-2,2-dimethylpropylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 89091301 |
| Molecular Formula | C17H21FN6OS |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[5-[(1Z)-1-[(1-amino-3-fluoro-2,2-dimethylpropylidene)amino]buta-1,3-dienyl]-4-methyl-1,3-thiazol-2-yl]imidazole-1-carboxamide |
| SMILES | C=C/C=C(\N=C(/N)C(C)(C)CF)c1sc(NC(=O)n2ccnc2)nc1C |
| InChI | InChI=1S/C17H21FN6OS/c1-5-6-12(22-14(19)17(3,4)9-18)13-11(2)21-15(26-13)23-16(25)24-8-7-20-10-24/h5-8,10H,1,9H2,2-4H3,(H2,19,22)(H,21,23,25)/b12-6- |
| InChIKey | ZVCLAKDAJVICCW-SDQBBNPISA-N |
| XLogP | 3.61 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|