About N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide
N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide (PubChem CID 59618305) has the molecular formula C11H8Cl2N4O
and a molecular weight of 283.12 g/mol. Its IUPAC name is N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide.
Molecular Properties
| Compound Name | N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide |
| PubChem CID | 59618305 |
| Molecular Formula | C11H8Cl2N4O |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide |
| SMILES | Nc1nccc(NC(=O)c2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C11H8Cl2N4O/c12-6-2-1-3-7(13)9(6)10(18)16-8-4-5-15-11(14)17-8/h1-5H,(H3,14,15,16,17,18) |
| InChIKey | ZNCLKLWDZRRFFW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide?
The IUPAC name of N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide (CID 59618305) is N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide.
What is the SMILES notation for N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide?
The canonical SMILES for N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide is Nc1nccc(NC(=O)c2c(Cl)cccc2Cl)n1.
What is the InChIKey of N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide?
The InChIKey is ZNCLKLWDZRRFFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2N4O/c12-6-2-1-3-7(13)9(6)10(18)16-8-4-5-15-11(14)17-8/h1-5H,(H3,14,15,16,17,18).
What are the key properties of N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide?
N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide has a molecular weight of 283.12 g/mol, XLogP of 2.62, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminopyrimidin-4-yl)-2,6-dichlorobenzamide is sourced from PubChem (CID 59618305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).