C19H25NO4S — CID 59620667
N-hydroxy-8-(5-methylnaphthalen-1-yl)sulfonyloctanamide (PubChem CID 59620667) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-hydroxy-8-(5-methylnaphthalen-1-yl)sulfonyloctanamide.
| Compound Name | N-hydroxy-8-(5-methylnaphthalen-1-yl)sulfonyloctanamide |
|---|---|
| PubChem CID | 59620667 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-hydroxy-8-(5-methylnaphthalen-1-yl)sulfonyloctanamide |
| SMILES | Cc1cccc2c(S(=O)(=O)CCCCCCCC(=O)NO)cccc12 |
| InChI | InChI=1S/C19H25NO4S/c1-15-9-7-11-17-16(15)10-8-12-18(17)25(23,24)14-6-4-2-3-5-13-19(21)20-22/h7-12,22H,2-6,13-14H2,1H3,(H,20,21) |
| InChIKey | FDHZHMBNNUAAPL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|