C13H17F3O6 — CID 59620792
bis(methoxymethyl) 2-prop-2-enyl-2-(1,1,2-trifluoroprop-2-enyl)propanedioate (PubChem CID 59620792) has the molecular formula C13H17F3O6 and a molecular weight of 326.27 g/mol. Its IUPAC name is bis(methoxymethyl) 2-prop-2-enyl-2-(1,1,2-trifluoroprop-2-enyl)propanedioate.
| Compound Name | bis(methoxymethyl) 2-prop-2-enyl-2-(1,1,2-trifluoroprop-2-enyl)propanedioate |
|---|---|
| PubChem CID | 59620792 |
| Molecular Formula | C13H17F3O6 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | bis(methoxymethyl) 2-prop-2-enyl-2-(1,1,2-trifluoroprop-2-enyl)propanedioate |
| SMILES | C=CCC(C(=O)OCOC)(C(=O)OCOC)C(F)(F)C(=C)F |
| InChI | InChI=1S/C13H17F3O6/c1-5-6-12(10(17)21-7-19-3,11(18)22-8-20-4)13(15,16)9(2)14/h5H,1-2,6-8H2,3-4H3 |
| InChIKey | RJNCKDPHLMREPH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|