C23H24FNO2S — CID 59621324
2-[(4aR,6S,8aS)-8a-(2-fluorophenyl)-6-methoxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]-1-phenylethanone (PubChem CID 59621324) has the molecular formula C23H24FNO2S and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[(4aR,6S,8aS)-8a-(2-fluorophenyl)-6-methoxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aR,6S,8aS)-8a-(2-fluorophenyl)-6-methoxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 59621324 |
| Molecular Formula | C23H24FNO2S |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-[(4aR,6S,8aS)-8a-(2-fluorophenyl)-6-methoxy-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]-1-phenylethanone |
| SMILES | CO[C@H]1CC[C@]2(c3ccccc3F)N=C(CC(=O)c3ccccc3)SC[C@@H]2C1 |
| InChI | InChI=1S/C23H24FNO2S/c1-27-18-11-12-23(19-9-5-6-10-20(19)24)17(13-18)15-28-22(25-23)14-21(26)16-7-3-2-4-8-16/h2-10,17-18H,11-15H2,1H3/t17-,18-,23-/m0/s1 |
| InChIKey | RPMSFGARBGYDHT-BSRJHKFKSA-N |
| XLogP | 5.25 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |