C33H19IrN2O3- — CID 59621768
3-(3H-dibenzofuran-3-id-4-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium;pyridine-2-carboxylic acid (PubChem CID 59621768) has the molecular formula C33H19IrN2O3- and a molecular weight of 683.74 g/mol. Its IUPAC name is 3-(3H-dibenzofuran-3-id-4-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium;pyridine-2-carboxylic acid.
| Compound Name | 3-(3H-dibenzofuran-3-id-4-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59621768 |
| Molecular Formula | C33H19IrN2O3- |
| Molecular Weight | 683.74 g/mol |
| Exact Mass | 684.10 |
| IUPAC Name | 3-(3H-dibenzofuran-3-id-4-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium;pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccccn1.[Ir].[c-]1ccc2c(oc3ccccc32)c1-c1cc2c3c(cccc3n1)-c1ccccc1-2 |
| InChI | InChI=1S/C27H14NO.C6H5NO2.Ir/c1-2-8-17-16(7-1)19-10-6-13-23-26(19)22(17)15-24(28-23)21-12-5-11-20-18-9-3-4-14-25(18)29-27(20)21;8-6(9)5-3-1-2-4-7-5;/h1-11,13-15H;1-4H,(H,8,9);/q-1;; |
| InChIKey | VANKYIFKEUZBKH-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.74 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|