C15H21NO7 — CID 59622439
(2R,3S)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbonyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 59622439) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is (2R,3S)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbonyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (2R,3S)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbonyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 59622439 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2R,3S)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbonyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCOC(=O)[C@@H]1C2C=CC(O2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C15H21NO7/c1-15(2,3)23-14(20)16-6-7-21-13(19)11-9-5-4-8(22-9)10(11)12(17)18/h4-5,8-11H,6-7H2,1-3H3,(H,16,20)(H,17,18)/t8?,9?,10-,11+/m0/s1 |
| InChIKey | DPERHWNTRBRIPB-WFBLGPOFSA-N |
| XLogP | 0.71 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|