C31H44N2O9 — CID 121320892
3-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-O-propyl 2-[(E)-3-[3-(methylamino)-3-oxopropoxy]prop-1-enyl]-5-[(E)-2-phenylethenyl]oxolane-3,4-dicarboxylate (PubChem CID 121320892) has the molecular formula C31H44N2O9 and a molecular weight of 588.70 g/mol. Its IUPAC name is 3-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-O-propyl 2-[(E)-3-[3-(methylamino)-3-oxopropoxy]prop-1-enyl]-5-[(E)-2-phenylethenyl]oxolane-3,4-dicarboxylate.
| Compound Name | 3-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-O-propyl 2-[(E)-3-[3-(methylamino)-3-oxopropoxy]prop-1-enyl]-5-[(E)-2-phenylethenyl]oxolane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 121320892 |
| Molecular Formula | C31H44N2O9 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 3-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-O-propyl 2-[(E)-3-[3-(methylamino)-3-oxopropoxy]prop-1-enyl]-5-[(E)-2-phenylethenyl]oxolane-3,4-dicarboxylate |
| SMILES | CCCOC(=O)C1C(/C=C/c2ccccc2)OC(/C=C/COCCC(=O)NC)C1C(=O)OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H44N2O9/c1-6-18-39-28(35)27-24(15-14-22-11-8-7-9-12-22)41-23(13-10-19-38-20-16-25(34)32-5)26(27)29(36)40-21-17-33-30(37)42-31(2,3)4/h7-15,23-24,26-27H,6,16-21H2,1-5H3,(H,32,34)(H,33,37)/b13-10+,15-14+ |
| InChIKey | GVNNVYDCWHCVQS-HFEXRDJISA-N |
| XLogP | 3.43 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|