C14H33ORfSi2- — CID 59623005
rutherfordium;trimethyl-(2,3,4-trimethyl-4-trimethylsilyloxypentan-2-yl)silane (PubChem CID 59623005) has the molecular formula C14H33ORfSi2- and a molecular weight of 540.59 g/mol. Its IUPAC name is rutherfordium;trimethyl-(2,3,4-trimethyl-4-trimethylsilyloxypentan-2-yl)silane.
| Compound Name | rutherfordium;trimethyl-(2,3,4-trimethyl-4-trimethylsilyloxypentan-2-yl)silane |
|---|---|
| PubChem CID | 59623005 |
| Molecular Formula | C14H33ORfSi2- |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | rutherfordium;trimethyl-(2,3,4-trimethyl-4-trimethylsilyloxypentan-2-yl)silane |
| SMILES | C[C-](C(C)(C)O[Si](C)(C)C)C(C)(C)[Si](C)(C)C.[Rf] |
| InChI | InChI=1S/C14H33OSi2.Rf/c1-12(14(4,5)16(6,7)8)13(2,3)15-17(9,10)11;/h1-11H3;/q-1; |
| InChIKey | OQUJPWKHWMYZCP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|