C16H38OSi2 — CID 20603291
trimethyl-(2,3,3,4-tetramethyl-4-trimethylsilylhexan-2-yl)oxysilane (PubChem CID 20603291) has the molecular formula C16H38OSi2 and a molecular weight of 302.65 g/mol. Its IUPAC name is trimethyl-(2,3,3,4-tetramethyl-4-trimethylsilylhexan-2-yl)oxysilane.
| Compound Name | trimethyl-(2,3,3,4-tetramethyl-4-trimethylsilylhexan-2-yl)oxysilane |
|---|---|
| PubChem CID | 20603291 |
| Molecular Formula | C16H38OSi2 |
| Molecular Weight | 302.65 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | trimethyl-(2,3,3,4-tetramethyl-4-trimethylsilylhexan-2-yl)oxysilane |
| SMILES | CCC(C)(C(C)(C)C(C)(C)O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H38OSi2/c1-13-16(6,18(7,8)9)14(2,3)15(4,5)17-19(10,11)12/h13H2,1-12H3 |
| InChIKey | UZFRZJNIPKPLTC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|