C16H38OSi2 — CID 18716500
trimethyl-(2,2,4-trimethyl-1-trimethylsilylheptan-4-yl)oxysilane (PubChem CID 18716500) has the molecular formula C16H38OSi2 and a molecular weight of 302.65 g/mol. Its IUPAC name is trimethyl-(2,2,4-trimethyl-1-trimethylsilylheptan-4-yl)oxysilane.
| Compound Name | trimethyl-(2,2,4-trimethyl-1-trimethylsilylheptan-4-yl)oxysilane |
|---|---|
| PubChem CID | 18716500 |
| Molecular Formula | C16H38OSi2 |
| Molecular Weight | 302.65 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | trimethyl-(2,2,4-trimethyl-1-trimethylsilylheptan-4-yl)oxysilane |
| SMILES | CCCC(C)(CC(C)(C)C[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H38OSi2/c1-11-12-16(4,17-19(8,9)10)13-15(2,3)14-18(5,6)7/h11-14H2,1-10H3 |
| InChIKey | GPXFFHLXCIUTKJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|