C16H35F3OSi2 — CID 18718400
trimethyl-[7,7,7-trifluoro-2,4-dimethyl-4-(trimethylsilylmethyl)heptan-2-yl]oxysilane (PubChem CID 18718400) has the molecular formula C16H35F3OSi2 and a molecular weight of 356.62 g/mol. Its IUPAC name is trimethyl-[7,7,7-trifluoro-2,4-dimethyl-4-(trimethylsilylmethyl)heptan-2-yl]oxysilane.
| Compound Name | trimethyl-[7,7,7-trifluoro-2,4-dimethyl-4-(trimethylsilylmethyl)heptan-2-yl]oxysilane |
|---|---|
| PubChem CID | 18718400 |
| Molecular Formula | C16H35F3OSi2 |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | trimethyl-[7,7,7-trifluoro-2,4-dimethyl-4-(trimethylsilylmethyl)heptan-2-yl]oxysilane |
| SMILES | CC(CCC(F)(F)F)(CC(C)(C)O[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C16H35F3OSi2/c1-14(2,20-22(7,8)9)12-15(3,13-21(4,5)6)10-11-16(17,18)19/h10-13H2,1-9H3 |
| InChIKey | WDQCMMNJLPEZGZ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|