C17H40OSi2 — CID 23566338
trimethyl-(2,4,6,6-tetramethyl-7-trimethylsilylheptan-2-yl)oxysilane (PubChem CID 23566338) has the molecular formula C17H40OSi2 and a molecular weight of 316.68 g/mol. Its IUPAC name is trimethyl-(2,4,6,6-tetramethyl-7-trimethylsilylheptan-2-yl)oxysilane.
| Compound Name | trimethyl-(2,4,6,6-tetramethyl-7-trimethylsilylheptan-2-yl)oxysilane |
|---|---|
| PubChem CID | 23566338 |
| Molecular Formula | C17H40OSi2 |
| Molecular Weight | 316.68 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | trimethyl-(2,4,6,6-tetramethyl-7-trimethylsilylheptan-2-yl)oxysilane |
| SMILES | CC(CC(C)(C)C[Si](C)(C)C)CC(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H40OSi2/c1-15(12-16(2,3)14-19(6,7)8)13-17(4,5)18-20(9,10)11/h15H,12-14H2,1-11H3 |
| InChIKey | JNJAABCHCKRIBA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|