C17H40OSi2 — CID 58607507
ethyl-[4-[[ethyl(dimethyl)silyl]methyl]-2,4-dimethylhexan-2-yl]oxy-dimethylsilane (PubChem CID 58607507) has the molecular formula C17H40OSi2 and a molecular weight of 316.68 g/mol. Its IUPAC name is ethyl-[4-[[ethyl(dimethyl)silyl]methyl]-2,4-dimethylhexan-2-yl]oxy-dimethylsilane.
| Compound Name | ethyl-[4-[[ethyl(dimethyl)silyl]methyl]-2,4-dimethylhexan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 58607507 |
| Molecular Formula | C17H40OSi2 |
| Molecular Weight | 316.68 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | ethyl-[4-[[ethyl(dimethyl)silyl]methyl]-2,4-dimethylhexan-2-yl]oxy-dimethylsilane |
| SMILES | CCC(C)(CC(C)(C)O[Si](C)(C)CC)C[Si](C)(C)CC |
| InChI | InChI=1S/C17H40OSi2/c1-11-17(6,15-19(7,8)12-2)14-16(4,5)18-20(9,10)13-3/h11-15H2,1-10H3 |
| InChIKey | ZEUYFWZMRPRCJB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|