C22H48O2Si — CID 91743739
bis(3,7-dimethyloctan-3-yloxy)-dimethylsilane (PubChem CID 91743739) has the molecular formula C22H48O2Si and a molecular weight of 372.71 g/mol. Its IUPAC name is bis(3,7-dimethyloctan-3-yloxy)-dimethylsilane.
| Compound Name | bis(3,7-dimethyloctan-3-yloxy)-dimethylsilane |
|---|---|
| PubChem CID | 91743739 |
| Molecular Formula | C22H48O2Si |
| Molecular Weight | 372.71 g/mol |
| Exact Mass | 372.34 |
| IUPAC Name | bis(3,7-dimethyloctan-3-yloxy)-dimethylsilane |
| SMILES | CCC(C)(CCCC(C)C)O[Si](C)(C)OC(C)(CC)CCCC(C)C |
| InChI | InChI=1S/C22H48O2Si/c1-11-21(7,17-13-15-19(3)4)23-25(9,10)24-22(8,12-2)18-14-16-20(5)6/h19-20H,11-18H2,1-10H3 |
| InChIKey | YGZRWCLFTQFPOH-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|