C18H42OSi2 — CID 59943032
trimethyl-(2,4,4,6,6-pentamethyl-7-trimethylsilylheptan-2-yl)oxysilane (PubChem CID 59943032) has the molecular formula C18H42OSi2 and a molecular weight of 330.71 g/mol. Its IUPAC name is trimethyl-(2,4,4,6,6-pentamethyl-7-trimethylsilylheptan-2-yl)oxysilane.
| Compound Name | trimethyl-(2,4,4,6,6-pentamethyl-7-trimethylsilylheptan-2-yl)oxysilane |
|---|---|
| PubChem CID | 59943032 |
| Molecular Formula | C18H42OSi2 |
| Molecular Weight | 330.71 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | trimethyl-(2,4,4,6,6-pentamethyl-7-trimethylsilylheptan-2-yl)oxysilane |
| SMILES | CC(C)(CC(C)(C)C[Si](C)(C)C)CC(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H42OSi2/c1-16(2,13-17(3,4)15-20(7,8)9)14-18(5,6)19-21(10,11)12/h13-15H2,1-12H3 |
| InChIKey | KKSMRTFCVSQTID-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.71 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|