C16H12F20O4 — CID 59628190
3-[[2-[difluoro-(1,1,2,2-tetrafluoro-3-hydroxypropoxy)methyl]-1,2,3,3,4,5,6,6-octafluoro-4,5-dimethylcyclohexyl]-difluoromethoxy]-2,2,3,3-tetrafluoropropan-1-ol (PubChem CID 59628190) has the molecular formula C16H12F20O4 and a molecular weight of 648.23 g/mol. Its IUPAC name is 3-[[2-[difluoro-(1,1,2,2-tetrafluoro-3-hydroxypropoxy)methyl]-1,2,3,3,4,5,6,6-octafluoro-4,5-dimethylcyclohexyl]-difluoromethoxy]-2,2,3,3-tetrafluoropropan-1-ol.
| Compound Name | 3-[[2-[difluoro-(1,1,2,2-tetrafluoro-3-hydroxypropoxy)methyl]-1,2,3,3,4,5,6,6-octafluoro-4,5-dimethylcyclohexyl]-difluoromethoxy]-2,2,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 59628190 |
| Molecular Formula | C16H12F20O4 |
| Molecular Weight | 648.23 g/mol |
| Exact Mass | 648.04 |
| IUPAC Name | 3-[[2-[difluoro-(1,1,2,2-tetrafluoro-3-hydroxypropoxy)methyl]-1,2,3,3,4,5,6,6-octafluoro-4,5-dimethylcyclohexyl]-difluoromethoxy]-2,2,3,3-tetrafluoropropan-1-ol |
| SMILES | CC1(F)C(C)(F)C(F)(F)C(F)(C(F)(F)OC(F)(F)C(F)(F)CO)C(F)(C(F)(F)OC(F)(F)C(F)(F)CO)C1(F)F |
| InChI | InChI=1S/C16H12F20O4/c1-5(17)6(2,18)12(27,28)10(24,16(35,36)40-14(31,32)8(21,22)4-38)9(23,11(5,25)26)15(33,34)39-13(29,30)7(19,20)3-37/h37-38H,3-4H2,1-2H3 |
| InChIKey | FMMITBGTWIDINR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.23 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|