C24H21F3N4S — CID 59633173
1-[4-[5-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]phenyl]piperazine (PubChem CID 59633173) has the molecular formula C24H21F3N4S and a molecular weight of 454.52 g/mol. Its IUPAC name is 1-[4-[5-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]phenyl]piperazine.
| Compound Name | 1-[4-[5-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]phenyl]piperazine |
|---|---|
| PubChem CID | 59633173 |
| Molecular Formula | C24H21F3N4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 1-[4-[5-[1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]thiophen-2-yl]phenyl]piperazine |
| SMILES | FC(F)(F)c1cc(-c2ccc(-c3ccc(N4CCNCC4)cc3)s2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H21F3N4S/c25-24(26,27)23-16-20(31(29-23)19-4-2-1-3-5-19)22-11-10-21(32-22)17-6-8-18(9-7-17)30-14-12-28-13-15-30/h1-11,16,28H,12-15H2 |
| InChIKey | DXAHPCNRVRHQLM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |