C16H28O4Si — CID 59638503
1-[(3aR,5S,6R,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 59638503) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-[(3aR,5S,6R,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | 1-[(3aR,5S,6R,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 59638503 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-[(3aR,5S,6R,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | CC[C@]1(C(O)C#C[Si](C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C16H28O4Si/c1-8-16(12(17)9-10-21(5,6)7)11(2)13-14(20-16)19-15(3,4)18-13/h11-14,17H,8H2,1-7H3/t11-,12?,13-,14+,16+/m1/s1 |
| InChIKey | YXJQHKXYTUOUAK-NOTZBRRKSA-N |
| XLogP | 2.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|