C5H11N2OP — CID 59641280
2-(phosphanyloxymethyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 59641280) has the molecular formula C5H11N2OP and a molecular weight of 146.13 g/mol. Its IUPAC name is 2-(phosphanyloxymethyl)-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | 2-(phosphanyloxymethyl)-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 59641280 |
| Molecular Formula | C5H11N2OP |
| Molecular Weight | 146.13 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2-(phosphanyloxymethyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | NC1=NC(COP)CC1 |
| InChI | InChI=1S/C5H11N2OP/c6-5-2-1-4(7-5)3-8-9/h4H,1-3,9H2,(H2,6,7) |
| InChIKey | JCXNSNFPRRWZPM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|