C24H32O10P- — CID 59641660
[(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] [3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylocta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] phosphate (PubChem CID 59641660) has the molecular formula C24H32O10P- and a molecular weight of 511.48 g/mol. Its IUPAC name is [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] [3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylocta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] phosphate.
| Compound Name | [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] [3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylocta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] phosphate |
|---|---|
| PubChem CID | 59641660 |
| Molecular Formula | C24H32O10P- |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] [3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylocta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] phosphate |
| SMILES | CC/C=C/C=C(C)/C=C/C1=C(C)C(=O)C(OP(=O)([O-])OC[C@H](O)[C@H]2OC(=O)C(O)=C2O)CC1(C)C |
| InChI | InChI=1S/C24H33O10P/c1-6-7-8-9-14(2)10-11-16-15(3)19(26)18(12-24(16,4)5)34-35(30,31)32-13-17(25)22-20(27)21(28)23(29)33-22/h7-11,17-18,22,25,27-28H,6,12-13H2,1-5H3,(H,30,31)/p-1/b8-7+,11-10+,14-9+/t17-,18?,22+/m0/s1 |
| InChIKey | AXGJGSWHWWDODD-VDPLVGGWSA-M |
| XLogP | 3.25 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|