C24H29N3O — CID 59643394
4-[2-[(4-ethylphenyl)methyl-(5-ethylpyrimidin-2-yl)amino]ethyl]-2-methylphenol (PubChem CID 59643394) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-[2-[(4-ethylphenyl)methyl-(5-ethylpyrimidin-2-yl)amino]ethyl]-2-methylphenol.
| Compound Name | 4-[2-[(4-ethylphenyl)methyl-(5-ethylpyrimidin-2-yl)amino]ethyl]-2-methylphenol |
|---|---|
| PubChem CID | 59643394 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 4-[2-[(4-ethylphenyl)methyl-(5-ethylpyrimidin-2-yl)amino]ethyl]-2-methylphenol |
| SMILES | CCc1ccc(CN(CCc2ccc(O)c(C)c2)c2ncc(CC)cn2)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-4-19-6-8-22(9-7-19)17-27(24-25-15-20(5-2)16-26-24)13-12-21-10-11-23(28)18(3)14-21/h6-11,14-16,28H,4-5,12-13,17H2,1-3H3 |
| InChIKey | JNRMTEFHITXHNI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |