C23H24N2O7 — CID 59645488
diethyl 2-[4-methoxycarbonyl-2-(2-methoxyphenyl)-1H-benzimidazol-5-yl]propanedioate (PubChem CID 59645488) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is diethyl 2-[4-methoxycarbonyl-2-(2-methoxyphenyl)-1H-benzimidazol-5-yl]propanedioate.
| Compound Name | diethyl 2-[4-methoxycarbonyl-2-(2-methoxyphenyl)-1H-benzimidazol-5-yl]propanedioate |
|---|---|
| PubChem CID | 59645488 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | diethyl 2-[4-methoxycarbonyl-2-(2-methoxyphenyl)-1H-benzimidazol-5-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ccc2[nH]c(-c3ccccc3OC)nc2c1C(=O)OC |
| InChI | InChI=1S/C23H24N2O7/c1-5-31-22(27)18(23(28)32-6-2)14-11-12-15-19(17(14)21(26)30-4)25-20(24-15)13-9-7-8-10-16(13)29-3/h7-12,18H,5-6H2,1-4H3,(H,24,25) |
| InChIKey | RKLURXYQLSKWDT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|