C23H28O6 — CID 59653237
(1R,7R,12R,17R)-6,11-dimethylspiro[8,19-dioxahexacyclo[15.2.1.01,6.07,9.07,16.011,15]icosane-12,5'-oxolane]-2',3,18-trione (PubChem CID 59653237) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is (1R,7R,12R,17R)-6,11-dimethylspiro[8,19-dioxahexacyclo[15.2.1.01,6.07,9.07,16.011,15]icosane-12,5'-oxolane]-2',3,18-trione.
| Compound Name | (1R,7R,12R,17R)-6,11-dimethylspiro[8,19-dioxahexacyclo[15.2.1.01,6.07,9.07,16.011,15]icosane-12,5'-oxolane]-2',3,18-trione |
|---|---|
| PubChem CID | 59653237 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (1R,7R,12R,17R)-6,11-dimethylspiro[8,19-dioxahexacyclo[15.2.1.01,6.07,9.07,16.011,15]icosane-12,5'-oxolane]-2',3,18-trione |
| SMILES | CC12CC3O[C@@]34C(C1CC[C@@]21CCC(=O)O1)[C@H]1C[C@]2(CC(=O)CCC24C)OC1=O |
| InChI | InChI=1S/C23H28O6/c1-19-11-15-23(27-15)17(14(19)4-7-21(19)8-5-16(25)28-21)13-10-22(29-18(13)26)9-12(24)3-6-20(22,23)2/h13-15,17H,3-11H2,1-2H3/t13-,14?,15?,17?,19?,20?,21-,22+,23-/m1/s1 |
| InChIKey | GKGPWXIAVWEPCW-GXBWORFJSA-N |
| XLogP | 2.71 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|