C24H32O6S — CID 90923579
(1R,2S,9R,14R,15S,17R)-9-ethylsulfonyl-2,15-dimethylspiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-ene-14,5'-oxolane]-2',5-dione (PubChem CID 90923579) has the molecular formula C24H32O6S and a molecular weight of 448.58 g/mol. Its IUPAC name is (1R,2S,9R,14R,15S,17R)-9-ethylsulfonyl-2,15-dimethylspiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-ene-14,5'-oxolane]-2',5-dione.
| Compound Name | (1R,2S,9R,14R,15S,17R)-9-ethylsulfonyl-2,15-dimethylspiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-ene-14,5'-oxolane]-2',5-dione |
|---|---|
| PubChem CID | 90923579 |
| Molecular Formula | C24H32O6S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (1R,2S,9R,14R,15S,17R)-9-ethylsulfonyl-2,15-dimethylspiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-7-ene-14,5'-oxolane]-2',5-dione |
| SMILES | CCS(=O)(=O)C1C=C2CC(=O)CC[C@]2(C)[C@@]23O[C@@H]2C[C@@]2(C)C(CC[C@@]24CCC(=O)O4)C13 |
| InChI | InChI=1S/C24H32O6S/c1-4-31(27,28)17-12-14-11-15(25)5-8-21(14,2)24-18(29-24)13-22(3)16(20(17)24)6-9-23(22)10-7-19(26)30-23/h12,16-18,20H,4-11,13H2,1-3H3/t16?,17?,18-,20?,21+,22+,23-,24-/m1/s1 |
| InChIKey | GDVYXRXLYIHYKM-HWQAIHRHSA-N |
| XLogP | 3.14 |
| TPSA | 90.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|