C23H28O4 — CID 91170503
(1R,2S,10R,11S,12S,15R,16S)-2,16-dimethylspiro[19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadec-7-ene-15,5'-oxolane]-2',5-dione (PubChem CID 91170503) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (1R,2S,10R,11S,12S,15R,16S)-2,16-dimethylspiro[19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadec-7-ene-15,5'-oxolane]-2',5-dione.
| Compound Name | (1R,2S,10R,11S,12S,15R,16S)-2,16-dimethylspiro[19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadec-7-ene-15,5'-oxolane]-2',5-dione |
|---|---|
| PubChem CID | 91170503 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (1R,2S,10R,11S,12S,15R,16S)-2,16-dimethylspiro[19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadec-7-ene-15,5'-oxolane]-2',5-dione |
| SMILES | C[C@]12CCC(=O)CC1=C1C[C@@H]1[C@H]1[C@@H]3CC[C@@]4(CCC(=O)O4)[C@@]3(C)CC3O[C@]312 |
| InChI | InChI=1S/C23H28O4/c1-20-6-3-12(24)9-16(20)13-10-14(13)19-15-4-7-22(8-5-18(25)27-22)21(15,2)11-17-23(19,20)26-17/h14-15,17,19H,3-11H2,1-2H3/t14-,15-,17?,19-,20-,21-,22+,23+/m0/s1 |
| InChIKey | PBQKJWZATGGSJX-DMRBNLNESA-N |
| XLogP | 3.73 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|