C23H40N4O3 — CID 59654227
N-[1-[(4-ethynyl-1-propylpiperidin-4-yl)amino]-5,5-dimethyl-1-oxohexan-2-yl]morpholine-4-carboxamide (PubChem CID 59654227) has the molecular formula C23H40N4O3 and a molecular weight of 420.60 g/mol. Its IUPAC name is N-[1-[(4-ethynyl-1-propylpiperidin-4-yl)amino]-5,5-dimethyl-1-oxohexan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[1-[(4-ethynyl-1-propylpiperidin-4-yl)amino]-5,5-dimethyl-1-oxohexan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 59654227 |
| Molecular Formula | C23H40N4O3 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | N-[1-[(4-ethynyl-1-propylpiperidin-4-yl)amino]-5,5-dimethyl-1-oxohexan-2-yl]morpholine-4-carboxamide |
| SMILES | C#CC1(NC(=O)C(CCC(C)(C)C)NC(=O)N2CCOCC2)CCN(CCC)CC1 |
| InChI | InChI=1S/C23H40N4O3/c1-6-12-26-13-10-23(7-2,11-14-26)25-20(28)19(8-9-22(3,4)5)24-21(29)27-15-17-30-18-16-27/h2,19H,6,8-18H2,1,3-5H3,(H,24,29)(H,25,28) |
| InChIKey | XGGPCBBOWKJDLP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|