C15H12F6IrN3O2- — CID 59656776
2-[4,5-bis(trifluoromethyl)imidazol-3-id-2-yl]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59656776) has the molecular formula C15H12F6IrN3O2- and a molecular weight of 572.49 g/mol. Its IUPAC name is 2-[4,5-bis(trifluoromethyl)imidazol-3-id-2-yl]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-[4,5-bis(trifluoromethyl)imidazol-3-id-2-yl]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59656776 |
| Molecular Formula | C15H12F6IrN3O2- |
| Molecular Weight | 572.49 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | 2-[4,5-bis(trifluoromethyl)imidazol-3-id-2-yl]pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.FC(F)(F)c1nc(-c2ccccn2)[n-]c1C(F)(F)F.[Ir] |
| InChI | InChI=1S/C10H4F6N3.C5H8O2.Ir/c11-9(12,13)6-7(10(14,15)16)19-8(18-6)5-3-1-2-4-17-5;1-4(6)3-5(2)7;/h1-4H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | GQSIIJPLVGCREM-LWFKIUJUSA-N |
| XLogP | 4.17 |
| TPSA | 77.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|