C6H4Na2O5S — CID 59657177
disodium;3,4-dihydroxybenzene-5-ide-1-sulfonate (PubChem CID 59657177) has the molecular formula C6H4Na2O5S and a molecular weight of 234.14 g/mol. Its IUPAC name is disodium;3,4-dihydroxybenzene-5-ide-1-sulfonate.
| Compound Name | disodium;3,4-dihydroxybenzene-5-ide-1-sulfonate |
|---|---|
| PubChem CID | 59657177 |
| Molecular Formula | C6H4Na2O5S |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | disodium;3,4-dihydroxybenzene-5-ide-1-sulfonate |
| SMILES | O=S(=O)([O-])c1c[c-]c(O)c(O)c1.[Na+].[Na+] |
| InChI | InChI=1S/C6H5O5S.2Na/c7-5-2-1-4(3-6(5)8)12(9,10)11;;/h1,3,7-8H,(H,9,10,11);;/q-1;2*+1/p-1 |
| InChIKey | TXOGWQAVLXILRQ-UHFFFAOYSA-M |
| XLogP | -6.19 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | -6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|