C6H4O8S2-2 — CID 20650842
3,4-dihydroxy-5-sulfinatooxybenzenesulfonate (PubChem CID 20650842) has the molecular formula C6H4O8S2-2 and a molecular weight of 268.22 g/mol. Its IUPAC name is 3,4-dihydroxy-5-sulfinatooxybenzenesulfonate.
| Compound Name | 3,4-dihydroxy-5-sulfinatooxybenzenesulfonate |
|---|---|
| PubChem CID | 20650842 |
| Molecular Formula | C6H4O8S2-2 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 267.94 |
| IUPAC Name | 3,4-dihydroxy-5-sulfinatooxybenzenesulfonate |
| SMILES | O=S([O-])Oc1cc(S(=O)(=O)[O-])cc(O)c1O |
| InChI | InChI=1S/C6H6O8S2/c7-4-1-3(16(11,12)13)2-5(6(4)8)14-15(9)10/h1-2,7-8H,(H,9,10)(H,11,12,13)/p-2 |
| InChIKey | DHMQYQZSISKVJS-UHFFFAOYSA-L |
| XLogP | -0.83 |
| TPSA | 147.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|