C8H6INNa2O7S2 — CID 23514902
disodium;3-[(2-iodoacetyl)amino]-4-sulfinatooxybenzenesulfonate (PubChem CID 23514902) has the molecular formula C8H6INNa2O7S2 and a molecular weight of 465.15 g/mol. Its IUPAC name is disodium;3-[(2-iodoacetyl)amino]-4-sulfinatooxybenzenesulfonate.
| Compound Name | disodium;3-[(2-iodoacetyl)amino]-4-sulfinatooxybenzenesulfonate |
|---|---|
| PubChem CID | 23514902 |
| Molecular Formula | C8H6INNa2O7S2 |
| Molecular Weight | 465.15 g/mol |
| Exact Mass | 464.84 |
| IUPAC Name | disodium;3-[(2-iodoacetyl)amino]-4-sulfinatooxybenzenesulfonate |
| SMILES | O=C(CI)Nc1cc(S(=O)(=O)[O-])ccc1OS(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H8INO7S2.2Na/c9-4-8(11)10-6-3-5(19(14,15)16)1-2-7(6)17-18(12)13;;/h1-3H,4H2,(H,10,11)(H,12,13)(H,14,15,16);;/q;2*+1/p-2 |
| InChIKey | ZDEPSYSTQZLVLM-UHFFFAOYSA-L |
| XLogP | -5.85 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.15 |
| LogP ≤ 5 | -5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|