C20H32NO13S- — CID 59657419
[(2R,4S)-2-[[(3S,4S)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-3,6,6-trimethyloxan-3-yl]methoxymethyl]-6-carboxy-4-hydroxy-2-methyl-3,4-dihydropyran-3-yl] sulfate (PubChem CID 59657419) has the molecular formula C20H32NO13S- and a molecular weight of 526.54 g/mol. Its IUPAC name is [(2R,4S)-2-[[(3S,4S)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-3,6,6-trimethyloxan-3-yl]methoxymethyl]-6-carboxy-4-hydroxy-2-methyl-3,4-dihydropyran-3-yl] sulfate.
| Compound Name | [(2R,4S)-2-[[(3S,4S)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-3,6,6-trimethyloxan-3-yl]methoxymethyl]-6-carboxy-4-hydroxy-2-methyl-3,4-dihydropyran-3-yl] sulfate |
|---|---|
| PubChem CID | 59657419 |
| Molecular Formula | C20H32NO13S- |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | [(2R,4S)-2-[[(3S,4S)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-3,6,6-trimethyloxan-3-yl]methoxymethyl]-6-carboxy-4-hydroxy-2-methyl-3,4-dihydropyran-3-yl] sulfate |
| SMILES | CC(=O)NC1[C@@H](O)[C@](C)(COC[C@@]2(C)OC(C(=O)O)=C[C@H](O)C2OS(=O)(=O)[O-])C(CO)OC1(C)C |
| InChI | InChI=1S/C20H33NO13S/c1-10(23)21-14-15(25)19(4,13(7-22)33-18(14,2)3)8-31-9-20(5)16(34-35(28,29)30)11(24)6-12(32-20)17(26)27/h6,11,13-16,22,24-25H,7-9H2,1-5H3,(H,21,23)(H,26,27)(H,28,29,30)/p-1/t11-,13?,14?,15+,16?,19+,20+/m0/s1 |
| InChIKey | VPAWAARVEJPTNO-YIDCMNKHSA-M |
| XLogP | -1.99 |
| TPSA | 221.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|