C20H25NO6 — CID 59658373
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-oxocyclopentanecarbonyl)phenyl]propanoic acid (PubChem CID 59658373) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-oxocyclopentanecarbonyl)phenyl]propanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-oxocyclopentanecarbonyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 59658373 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-oxocyclopentanecarbonyl)phenyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(C(=O)C2CCCC2=O)cc1)C(=O)O |
| InChI | InChI=1S/C20H25NO6/c1-20(2,3)27-19(26)21-15(18(24)25)11-12-7-9-13(10-8-12)17(23)14-5-4-6-16(14)22/h7-10,14-15H,4-6,11H2,1-3H3,(H,21,26)(H,24,25) |
| InChIKey | IKLJNBBZRLTEQQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|