C9H6Cl2 — CID 59659323
1,3-dichloro-2-prop-1-ynylbenzene (PubChem CID 59659323) has the molecular formula C9H6Cl2 and a molecular weight of 185.05 g/mol. Its IUPAC name is 1,3-dichloro-2-prop-1-ynylbenzene.
| Compound Name | 1,3-dichloro-2-prop-1-ynylbenzene |
|---|---|
| PubChem CID | 59659323 |
| Molecular Formula | C9H6Cl2 |
| Molecular Weight | 185.05 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | 1,3-dichloro-2-prop-1-ynylbenzene |
| SMILES | CC#Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H6Cl2/c1-2-4-7-8(10)5-3-6-9(7)11/h3,5-6H,1H3 |
| InChIKey | LVPMNEYJTHVGAO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.05 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|