C13H14Cl2 — CID 83924958
1,3-dichloro-2-(3-methylhex-4-yn-2-yl)benzene (PubChem CID 83924958) has the molecular formula C13H14Cl2 and a molecular weight of 241.16 g/mol. Its IUPAC name is 1,3-dichloro-2-(3-methylhex-4-yn-2-yl)benzene.
| Compound Name | 1,3-dichloro-2-(3-methylhex-4-yn-2-yl)benzene |
|---|---|
| PubChem CID | 83924958 |
| Molecular Formula | C13H14Cl2 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1,3-dichloro-2-(3-methylhex-4-yn-2-yl)benzene |
| SMILES | CC#CC(C)C(C)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H14Cl2/c1-4-6-9(2)10(3)13-11(14)7-5-8-12(13)15/h5,7-10H,1-3H3 |
| InChIKey | MBRHOQRNRKLIIQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|