C14H16Cl2 — CID 83924957
1,3-dichloro-2-(3-methylhept-4-yn-2-yl)benzene (PubChem CID 83924957) has the molecular formula C14H16Cl2 and a molecular weight of 255.19 g/mol. Its IUPAC name is 1,3-dichloro-2-(3-methylhept-4-yn-2-yl)benzene.
| Compound Name | 1,3-dichloro-2-(3-methylhept-4-yn-2-yl)benzene |
|---|---|
| PubChem CID | 83924957 |
| Molecular Formula | C14H16Cl2 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 1,3-dichloro-2-(3-methylhept-4-yn-2-yl)benzene |
| SMILES | CCC#CC(C)C(C)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H16Cl2/c1-4-5-7-10(2)11(3)14-12(15)8-6-9-13(14)16/h6,8-11H,4H2,1-3H3 |
| InChIKey | MPQWYJIVXDJSFM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|