C57H50O21S3 — CID 59660046
2-[1,1-bis[2-[2-(9,10-dioxothioxanthen-2-yl)oxyacetyl]oxyethoxymethoxy]propoxymethoxy]ethyl 2-(9,10-dioxothioxanthen-2-yl)oxyacetate (PubChem CID 59660046) has the molecular formula C57H50O21S3 and a molecular weight of 1167.21 g/mol. Its IUPAC name is 2-[1,1-bis[2-[2-(9,10-dioxothioxanthen-2-yl)oxyacetyl]oxyethoxymethoxy]propoxymethoxy]ethyl 2-(9,10-dioxothioxanthen-2-yl)oxyacetate.
| Compound Name | 2-[1,1-bis[2-[2-(9,10-dioxothioxanthen-2-yl)oxyacetyl]oxyethoxymethoxy]propoxymethoxy]ethyl 2-(9,10-dioxothioxanthen-2-yl)oxyacetate |
|---|---|
| PubChem CID | 59660046 |
| Molecular Formula | C57H50O21S3 |
| Molecular Weight | 1167.21 g/mol |
| Exact Mass | 1166.20 |
| IUPAC Name | 2-[1,1-bis[2-[2-(9,10-dioxothioxanthen-2-yl)oxyacetyl]oxyethoxymethoxy]propoxymethoxy]ethyl 2-(9,10-dioxothioxanthen-2-yl)oxyacetate |
| SMILES | CCC(OCOCCOC(=O)COc1ccc2c(c1)C(=O)c1ccccc1S2=O)(OCOCCOC(=O)COc1ccc2c(c1)C(=O)c1ccccc1S2=O)OCOCCOC(=O)COc1ccc2c(c1)C(=O)c1ccccc1S2=O |
| InChI | InChI=1S/C57H50O21S3/c1-2-57(76-33-67-21-24-70-51(58)30-73-36-15-18-48-42(27-36)54(61)39-9-3-6-12-45(39)79(48)64,77-34-68-22-25-71-52(59)31-74-37-16-19-49-43(28-37)55(62)40-10-4-7-13-46(40)80(49)65)78-35-69-23-26-72-53(60)32-75-38-17-20-50-44(29-38)56(63)41-11-5-8-14-47(41)81(50)66/h3-20,27-29H,2,21-26,30-35H2,1H3 |
| InChIKey | GABLYQGMNSTWAF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 264.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1167.21 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|