C20H19N5OS — CID 59662257
N-(4-morpholin-4-ylphenyl)-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 59662257) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 59662257 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-3-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | c1csc(-c2cnn3ccc(Nc4ccc(N5CCOCC5)cc4)nc23)c1 |
| InChI | InChI=1S/C20H19N5OS/c1-2-18(27-13-1)17-14-21-25-8-7-19(23-20(17)25)22-15-3-5-16(6-4-15)24-9-11-26-12-10-24/h1-8,13-14H,9-12H2,(H,22,23) |
| InChIKey | QMVSVIRXMRQENG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|