C25H20F7NO2 — CID 59663845
(7S,8S)-7-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-8-(4-fluorophenyl)-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium (PubChem CID 59663845) has the molecular formula C25H20F7NO2 and a molecular weight of 499.43 g/mol. Its IUPAC name is (7S,8S)-7-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-8-(4-fluorophenyl)-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium.
| Compound Name | (7S,8S)-7-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-8-(4-fluorophenyl)-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium |
|---|---|
| PubChem CID | 59663845 |
| Molecular Formula | C25H20F7NO2 |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | (7S,8S)-7-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-8-(4-fluorophenyl)-1-oxido-5,6,7,8-tetrahydroquinolin-1-ium |
| SMILES | C[C@H](O[C@H]1CCc2ccc[n+]([O-])c2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H20F7NO2/c1-14(17-11-18(24(27,28)29)13-19(12-17)25(30,31)32)35-21-9-6-16-3-2-10-33(34)23(16)22(21)15-4-7-20(26)8-5-15/h2-5,7-8,10-14,21-22H,6,9H2,1H3/t14-,21-,22+/m0/s1 |
| InChIKey | FMMURIPEXBHJPQ-JQOQJDEVSA-N |
| XLogP | 6.72 |
| TPSA | 36.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|