C29H45NO7 — CID 59663873
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-[2-(3,4-dihydroxyphenyl)-1-hydroxyethyl]-N-methylhept-5-enamide (PubChem CID 59663873) has the molecular formula C29H45NO7 and a molecular weight of 519.68 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-[2-(3,4-dihydroxyphenyl)-1-hydroxyethyl]-N-methylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-[2-(3,4-dihydroxyphenyl)-1-hydroxyethyl]-N-methylhept-5-enamide |
|---|---|
| PubChem CID | 59663873 |
| Molecular Formula | C29H45NO7 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-[2-(3,4-dihydroxyphenyl)-1-hydroxyethyl]-N-methylhept-5-enamide |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)N(C)C(O)Cc2ccc(O)c(O)c2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C29H45NO7/c1-3-4-7-10-21(31)14-15-23-22(25(33)19-26(23)34)11-8-5-6-9-12-28(36)30(2)29(37)18-20-13-16-24(32)27(35)17-20/h5,8,13-17,21-23,25-26,29,31-35,37H,3-4,6-7,9-12,18-19H2,1-2H3/b8-5-,15-14+/t21-,22+,23+,25-,26+,29?/m0/s1 |
| InChIKey | AEIWQGXRCJPNJL-PCVSGYDXSA-N |
| XLogP | 3.39 |
| TPSA | 141.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|