C29H45NO7 — CID 91483277
N-[2-(3,4-dihydroxyphenyl)-1-hydroxyethyl]-7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]-N-methylheptanamide (PubChem CID 91483277) has the molecular formula C29H45NO7 and a molecular weight of 519.68 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)-1-hydroxyethyl]-7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]-N-methylheptanamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)-1-hydroxyethyl]-7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]-N-methylheptanamide |
|---|---|
| PubChem CID | 91483277 |
| Molecular Formula | C29H45NO7 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)-1-hydroxyethyl]-7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]-N-methylheptanamide |
| SMILES | CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)N(C)C(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C29H45NO7/c1-3-4-7-10-21(31)14-15-23-22(25(33)19-26(23)34)11-8-5-6-9-12-28(36)30(2)29(37)18-20-13-16-24(32)27(35)17-20/h13-17,21-23,26,29,31-32,34-35,37H,3-12,18-19H2,1-2H3/t21-,22+,23+,26+,29?/m0/s1 |
| InChIKey | RXZZKPUSVHUZIM-VFQXZORBSA-N |
| XLogP | 3.82 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|