About 2-aminoethyl 2-methylbutyl phosphite
2-aminoethyl 2-methylbutyl phosphite (PubChem CID 59668450) has the molecular formula C7H17NO3P-
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-aminoethyl 2-methylbutyl phosphite.
Molecular Properties
| Compound Name | 2-aminoethyl 2-methylbutyl phosphite |
| PubChem CID | 59668450 |
| Molecular Formula | C7H17NO3P- |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 2-aminoethyl 2-methylbutyl phosphite |
| SMILES | CCC(C)COP([O-])OCCN |
| InChI | InChI=1S/C7H17NO3P/c1-3-7(2)6-11-12(9)10-5-4-8/h7H,3-6,8H2,1-2H3/q-1 |
| InChIKey | ZYCPXFFLMHTKBK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 67.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl 2-methylbutyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 2-methylbutyl phosphite?
The IUPAC name of 2-aminoethyl 2-methylbutyl phosphite (CID 59668450) is 2-aminoethyl 2-methylbutyl phosphite.
What is the SMILES notation for 2-aminoethyl 2-methylbutyl phosphite?
The canonical SMILES for 2-aminoethyl 2-methylbutyl phosphite is CCC(C)COP([O-])OCCN.
What is the InChIKey of 2-aminoethyl 2-methylbutyl phosphite?
The InChIKey is ZYCPXFFLMHTKBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO3P/c1-3-7(2)6-11-12(9)10-5-4-8/h7H,3-6,8H2,1-2H3/q-1.
What are the key properties of 2-aminoethyl 2-methylbutyl phosphite?
2-aminoethyl 2-methylbutyl phosphite has a molecular weight of 194.19 g/mol, XLogP of 0.61, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 2-methylbutyl phosphite is sourced from PubChem (CID 59668450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).