C19H23ClN2O6S — CID 59679502
tert-butyl (6Z)-9-(4-chlorophenyl)sulfonyl-6-(hydroxymethylidene)-7-oxo-3,9-diazabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 59679502) has the molecular formula C19H23ClN2O6S and a molecular weight of 442.92 g/mol. Its IUPAC name is tert-butyl (6Z)-9-(4-chlorophenyl)sulfonyl-6-(hydroxymethylidene)-7-oxo-3,9-diazabicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | tert-butyl (6Z)-9-(4-chlorophenyl)sulfonyl-6-(hydroxymethylidene)-7-oxo-3,9-diazabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 59679502 |
| Molecular Formula | C19H23ClN2O6S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | tert-butyl (6Z)-9-(4-chlorophenyl)sulfonyl-6-(hydroxymethylidene)-7-oxo-3,9-diazabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(=O)/C(=C\O)C(C1)N2S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClN2O6S/c1-19(2,3)28-18(25)21-9-13-8-17(24)15(11-23)16(10-21)22(13)29(26,27)14-6-4-12(20)5-7-14/h4-7,11,13,16,23H,8-10H2,1-3H3/b15-11- |
| InChIKey | FZBLMNQKARJMDW-PTNGSMBKSA-N |
| XLogP | 2.73 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|