C14H14ClNO5S — CID 59679491
(6Z)-9-(4-chlorophenyl)sulfonyl-6-(hydroxymethylidene)-3-oxa-9-azabicyclo[3.3.1]nonan-7-one (PubChem CID 59679491) has the molecular formula C14H14ClNO5S and a molecular weight of 343.79 g/mol. Its IUPAC name is (6Z)-9-(4-chlorophenyl)sulfonyl-6-(hydroxymethylidene)-3-oxa-9-azabicyclo[3.3.1]nonan-7-one.
| Compound Name | (6Z)-9-(4-chlorophenyl)sulfonyl-6-(hydroxymethylidene)-3-oxa-9-azabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 59679491 |
| Molecular Formula | C14H14ClNO5S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | (6Z)-9-(4-chlorophenyl)sulfonyl-6-(hydroxymethylidene)-3-oxa-9-azabicyclo[3.3.1]nonan-7-one |
| SMILES | O=C1CC2COCC(/C1=C/O)N2S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClNO5S/c15-9-1-3-11(4-2-9)22(19,20)16-10-5-14(18)12(6-17)13(16)8-21-7-10/h1-4,6,10,13,17H,5,7-8H2/b12-6- |
| InChIKey | ZTIRNXTZTXSLCW-SDQBBNPISA-N |
| XLogP | 1.51 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|