C13H14ClNO4S2 — CID 66842486
(2E)-9-(5-chlorothiophen-2-yl)sulfonyl-2-(hydroxymethylidene)-9-azabicyclo[3.3.1]nonan-3-one (PubChem CID 66842486) has the molecular formula C13H14ClNO4S2 and a molecular weight of 347.85 g/mol. Its IUPAC name is (2E)-9-(5-chlorothiophen-2-yl)sulfonyl-2-(hydroxymethylidene)-9-azabicyclo[3.3.1]nonan-3-one.
| Compound Name | (2E)-9-(5-chlorothiophen-2-yl)sulfonyl-2-(hydroxymethylidene)-9-azabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 66842486 |
| Molecular Formula | C13H14ClNO4S2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (2E)-9-(5-chlorothiophen-2-yl)sulfonyl-2-(hydroxymethylidene)-9-azabicyclo[3.3.1]nonan-3-one |
| SMILES | O=C1CC2CCCC(/C1=C\O)N2S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H14ClNO4S2/c14-12-4-5-13(20-12)21(18,19)15-8-2-1-3-10(15)9(7-16)11(17)6-8/h4-5,7-8,10,16H,1-3,6H2/b9-7+ |
| InChIKey | SCKFORUEAMGQQN-VQHVLOKHSA-N |
| XLogP | 2.73 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|